C21H30N2O6 — CID 58220227
3-(3,4-dihydroxyphenyl)-2-[2-[(E)-2-(3-hydroxybut-3-en-2-yl)hept-4-enoyl]hydrazinyl]-2-methylpropanoic acid (PubChem CID 58220227) has the molecular formula C21H30N2O6 and a molecular weight of 406.48 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-[2-[(E)-2-(3-hydroxybut-3-en-2-yl)hept-4-enoyl]hydrazinyl]-2-methylpropanoic acid.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-[2-[(E)-2-(3-hydroxybut-3-en-2-yl)hept-4-enoyl]hydrazinyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 58220227 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-[2-[(E)-2-(3-hydroxybut-3-en-2-yl)hept-4-enoyl]hydrazinyl]-2-methylpropanoic acid |
| SMILES | C=C(O)C(C)C(C/C=C/CC)C(=O)NNC(C)(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C21H30N2O6/c1-5-6-7-8-16(13(2)14(3)24)19(27)22-23-21(4,20(28)29)12-15-9-10-17(25)18(26)11-15/h6-7,9-11,13,16,23-26H,3,5,8,12H2,1-2,4H3,(H,22,27)(H,28,29)/b7-6+ |
| InChIKey | SUOKXXWPDYDEHB-VOTSOKGWSA-N |
| XLogP | 2.78 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|