C22H33NO8 — CID 22814831
1-[(2S)-3-(3,4-dihydroxyphenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]oxyethyl 2,2-dimethylpropanoate (PubChem CID 22814831) has the molecular formula C22H33NO8 and a molecular weight of 439.51 g/mol. Its IUPAC name is 1-[(2S)-3-(3,4-dihydroxyphenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]oxyethyl 2,2-dimethylpropanoate.
| Compound Name | 1-[(2S)-3-(3,4-dihydroxyphenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]oxyethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 22814831 |
| Molecular Formula | C22H33NO8 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 1-[(2S)-3-(3,4-dihydroxyphenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]oxyethyl 2,2-dimethylpropanoate |
| SMILES | CC(OC(=O)C(C)(C)C)OC(=O)[C@](C)(Cc1ccc(O)c(O)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33NO8/c1-13(29-17(26)20(2,3)4)30-18(27)22(8,23-19(28)31-21(5,6)7)12-14-9-10-15(24)16(25)11-14/h9-11,13,24-25H,12H2,1-8H3,(H,23,28)/t13?,22-/m0/s1 |
| InChIKey | HJHHBCRGTCKIOQ-OGDGHAERSA-N |
| XLogP | 3.40 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|