C26H41NO10 — CID 12048084
methyl (2S)-3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 12048084) has the molecular formula C26H41NO10 and a molecular weight of 527.61 g/mol. Its IUPAC name is methyl (2S)-3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2S)-3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 12048084 |
| Molecular Formula | C26H41NO10 |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | methyl (2S)-3-(2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@](C)(Cc1ccc2c(c1)OCCOCCOCCOCCOCCO2)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H41NO10/c1-25(2,3)37-24(29)27-26(4,23(28)30-5)19-20-6-7-21-22(18-20)36-17-15-34-13-11-32-9-8-31-10-12-33-14-16-35-21/h6-7,18H,8-17,19H2,1-5H3,(H,27,29)/t26-/m0/s1 |
| InChIKey | HWTHMMXAKOCZQW-SANMLTNESA-N |
| XLogP | 2.52 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |