C20H31N3O4 — CID 91093950
tert-butyl N-(azepan-1-yl)-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)carbamate (PubChem CID 91093950) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is tert-butyl N-(azepan-1-yl)-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)carbamate.
| Compound Name | tert-butyl N-(azepan-1-yl)-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)carbamate |
|---|---|
| PubChem CID | 91093950 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | tert-butyl N-(azepan-1-yl)-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethylamino)carbamate |
| SMILES | CC(C)(C)OC(=O)N(NCc1ccc2c(c1)OCCO2)N1CCCCCC1 |
| InChI | InChI=1S/C20H31N3O4/c1-20(2,3)27-19(24)23(22-10-6-4-5-7-11-22)21-15-16-8-9-17-18(14-16)26-13-12-25-17/h8-9,14,21H,4-7,10-13,15H2,1-3H3 |
| InChIKey | CMNQXZLAYGCZOQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|