C16H26N2O4 — CID 102809695
tert-butyl N-[4-[(3,4-dihydroxyphenyl)methylamino]butan-2-yl]carbamate (PubChem CID 102809695) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is tert-butyl N-[4-[(3,4-dihydroxyphenyl)methylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(3,4-dihydroxyphenyl)methylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 102809695 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | tert-butyl N-[4-[(3,4-dihydroxyphenyl)methylamino]butan-2-yl]carbamate |
| SMILES | CC(CCNCc1ccc(O)c(O)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26N2O4/c1-11(18-15(21)22-16(2,3)4)7-8-17-10-12-5-6-13(19)14(20)9-12/h5-6,9,11,17,19-20H,7-8,10H2,1-4H3,(H,18,21) |
| InChIKey | LPVLVNRNBOBVNV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|