C15H24N2O4S — CID 107246933
5-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]methyl]thiophene-3-carboxylic acid (PubChem CID 107246933) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is 5-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]methyl]thiophene-3-carboxylic acid.
| Compound Name | 5-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]methyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 107246933 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 5-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]methyl]thiophene-3-carboxylic acid |
| SMILES | CC(CCNCc1cc(C(=O)O)cs1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24N2O4S/c1-10(17-14(20)21-15(2,3)4)5-6-16-8-12-7-11(9-22-12)13(18)19/h7,9-10,16H,5-6,8H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | IBHUHOKJYJROGU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|