C15H23N3O3S — CID 107252829
tert-butyl N-[(E)-4-[(4-carbamoylthiophen-2-yl)methylamino]but-2-enyl]carbamate (PubChem CID 107252829) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[(4-carbamoylthiophen-2-yl)methylamino]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[(4-carbamoylthiophen-2-yl)methylamino]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 107252829 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | tert-butyl N-[(E)-4-[(4-carbamoylthiophen-2-yl)methylamino]but-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C=C/CNCc1cc(C(N)=O)cs1 |
| InChI | InChI=1S/C15H23N3O3S/c1-15(2,3)21-14(20)18-7-5-4-6-17-9-12-8-11(10-22-12)13(16)19/h4-5,8,10,17H,6-7,9H2,1-3H3,(H2,16,19)(H,18,20)/b5-4+ |
| InChIKey | NQARWICEDLCCLS-SNAWJCMRSA-N |
| XLogP | 2.02 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|