C10H13F3N2OS — CID 81463264
5-[(4,4,4-trifluorobutylamino)methyl]thiophene-3-carboxamide (PubChem CID 81463264) has the molecular formula C10H13F3N2OS and a molecular weight of 266.29 g/mol. Its IUPAC name is 5-[(4,4,4-trifluorobutylamino)methyl]thiophene-3-carboxamide.
| Compound Name | 5-[(4,4,4-trifluorobutylamino)methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 81463264 |
| Molecular Formula | C10H13F3N2OS |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 5-[(4,4,4-trifluorobutylamino)methyl]thiophene-3-carboxamide |
| SMILES | NC(=O)c1csc(CNCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H13F3N2OS/c11-10(12,13)2-1-3-15-5-8-4-7(6-17-8)9(14)16/h4,6,15H,1-3,5H2,(H2,14,16) |
| InChIKey | HXQKPBHJXMQRAU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|