C12H15F3N2O — CID 79039829
3-[(4,4,4-trifluorobutylamino)methyl]benzamide (PubChem CID 79039829) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 3-[(4,4,4-trifluorobutylamino)methyl]benzamide.
| Compound Name | 3-[(4,4,4-trifluorobutylamino)methyl]benzamide |
|---|---|
| PubChem CID | 79039829 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-[(4,4,4-trifluorobutylamino)methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O/c13-12(14,15)5-2-6-17-8-9-3-1-4-10(7-9)11(16)18/h1,3-4,7,17H,2,5-6,8H2,(H2,16,18) |
| InChIKey | PQOLKORAHQKZJE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|