C12H18N2OS — CID 43426792
3-[(3-methylsulfanylpropylamino)methyl]benzamide (PubChem CID 43426792) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 3-[(3-methylsulfanylpropylamino)methyl]benzamide.
| Compound Name | 3-[(3-methylsulfanylpropylamino)methyl]benzamide |
|---|---|
| PubChem CID | 43426792 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-[(3-methylsulfanylpropylamino)methyl]benzamide |
| SMILES | CSCCCNCc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C12H18N2OS/c1-16-7-3-6-14-9-10-4-2-5-11(8-10)12(13)15/h2,4-5,8,14H,3,6-7,9H2,1H3,(H2,13,15) |
| InChIKey | JDAJBCHTHNJDIN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|