C12H20N2OS — CID 79613545
5-[(2,3-dimethylbutylamino)methyl]thiophene-3-carboxamide (PubChem CID 79613545) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 5-[(2,3-dimethylbutylamino)methyl]thiophene-3-carboxamide.
| Compound Name | 5-[(2,3-dimethylbutylamino)methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79613545 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 5-[(2,3-dimethylbutylamino)methyl]thiophene-3-carboxamide |
| SMILES | CC(C)C(C)CNCc1cc(C(N)=O)cs1 |
| InChI | InChI=1S/C12H20N2OS/c1-8(2)9(3)5-14-6-11-4-10(7-16-11)12(13)15/h4,7-9,14H,5-6H2,1-3H3,(H2,13,15) |
| InChIKey | STZCFIGSVXCDCN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |