C15H25N3OS — CID 79613485
5-[[(3-methyl-2-pyrrolidin-1-ylbutyl)amino]methyl]thiophene-3-carboxamide (PubChem CID 79613485) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is 5-[[(3-methyl-2-pyrrolidin-1-ylbutyl)amino]methyl]thiophene-3-carboxamide.
| Compound Name | 5-[[(3-methyl-2-pyrrolidin-1-ylbutyl)amino]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79613485 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 5-[[(3-methyl-2-pyrrolidin-1-ylbutyl)amino]methyl]thiophene-3-carboxamide |
| SMILES | CC(C)C(CNCc1cc(C(N)=O)cs1)N1CCCC1 |
| InChI | InChI=1S/C15H25N3OS/c1-11(2)14(18-5-3-4-6-18)9-17-8-13-7-12(10-20-13)15(16)19/h7,10-11,14,17H,3-6,8-9H2,1-2H3,(H2,16,19) |
| InChIKey | CMOBCOJRMYZARD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |