C12H20N2O3S — CID 79614481
5-[(2,2-diethoxyethylamino)methyl]thiophene-3-carboxamide (PubChem CID 79614481) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 5-[(2,2-diethoxyethylamino)methyl]thiophene-3-carboxamide.
| Compound Name | 5-[(2,2-diethoxyethylamino)methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79614481 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 5-[(2,2-diethoxyethylamino)methyl]thiophene-3-carboxamide |
| SMILES | CCOC(CNCc1cc(C(N)=O)cs1)OCC |
| InChI | InChI=1S/C12H20N2O3S/c1-3-16-11(17-4-2)7-14-6-10-5-9(8-18-10)12(13)15/h5,8,11,14H,3-4,6-7H2,1-2H3,(H2,13,15) |
| InChIKey | ONJHQCMFFADJCX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|