C10H14N2OS — CID 115735684
5-[[(1-methylcyclopropyl)amino]methyl]thiophene-3-carboxamide (PubChem CID 115735684) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 5-[[(1-methylcyclopropyl)amino]methyl]thiophene-3-carboxamide.
| Compound Name | 5-[[(1-methylcyclopropyl)amino]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 115735684 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 5-[[(1-methylcyclopropyl)amino]methyl]thiophene-3-carboxamide |
| SMILES | CC1(NCc2cc(C(N)=O)cs2)CC1 |
| InChI | InChI=1S/C10H14N2OS/c1-10(2-3-10)12-5-8-4-7(6-14-8)9(11)13/h4,6,12H,2-3,5H2,1H3,(H2,11,13) |
| InChIKey | DTCKTBZIDXIGFN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |