C11H13N3OS2 — CID 79613625
5-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]thiophene-3-carboxamide (PubChem CID 79613625) has the molecular formula C11H13N3OS2 and a molecular weight of 267.38 g/mol. Its IUPAC name is 5-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]thiophene-3-carboxamide.
| Compound Name | 5-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79613625 |
| Molecular Formula | C11H13N3OS2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 5-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]thiophene-3-carboxamide |
| SMILES | NC(=O)c1csc(CNCCc2cscn2)c1 |
| InChI | InChI=1S/C11H13N3OS2/c12-11(15)8-3-10(17-5-8)4-13-2-1-9-6-16-7-14-9/h3,5-7,13H,1-2,4H2,(H2,12,15) |
| InChIKey | IAOIRBWVLUIXID-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|