C10H10BrClN2S2 — CID 102835791
N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-(1,3-thiazol-4-yl)ethanamine (PubChem CID 102835791) has the molecular formula C10H10BrClN2S2 and a molecular weight of 337.70 g/mol. Its IUPAC name is N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-(1,3-thiazol-4-yl)ethanamine.
| Compound Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-(1,3-thiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 102835791 |
| Molecular Formula | C10H10BrClN2S2 |
| Molecular Weight | 337.70 g/mol |
| Exact Mass | 335.92 |
| IUPAC Name | N-[(4-bromo-5-chlorothiophen-2-yl)methyl]-2-(1,3-thiazol-4-yl)ethanamine |
| SMILES | Clc1sc(CNCCc2cscn2)cc1Br |
| InChI | InChI=1S/C10H10BrClN2S2/c11-9-3-8(16-10(9)12)4-13-2-1-7-5-15-6-14-7/h3,5-6,13H,1-2,4H2 |
| InChIKey | FQNTUNBXHUGLJC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|