C11H12ClN3S — CID 115683711
N-[(6-chloro-3-pyridinyl)methyl]-2-(1,3-thiazol-4-yl)ethanamine (PubChem CID 115683711) has the molecular formula C11H12ClN3S and a molecular weight of 253.76 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-2-(1,3-thiazol-4-yl)ethanamine.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-2-(1,3-thiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 115683711 |
| Molecular Formula | C11H12ClN3S |
| Molecular Weight | 253.76 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-2-(1,3-thiazol-4-yl)ethanamine |
| SMILES | Clc1ccc(CNCCc2cscn2)cn1 |
| InChI | InChI=1S/C11H12ClN3S/c12-11-2-1-9(6-14-11)5-13-4-3-10-7-16-8-15-10/h1-2,6-8,13H,3-5H2 |
| InChIKey | IYSIYYBMNDKAOC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.76 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|