C11H13N3S — CID 63829197
N-(pyridin-2-ylmethyl)-2-(1,3-thiazol-4-yl)ethanamine (PubChem CID 63829197) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-2-(1,3-thiazol-4-yl)ethanamine.
| Compound Name | N-(pyridin-2-ylmethyl)-2-(1,3-thiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 63829197 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-2-(1,3-thiazol-4-yl)ethanamine |
| SMILES | c1ccc(CNCCc2cscn2)nc1 |
| InChI | InChI=1S/C11H13N3S/c1-2-5-13-10(3-1)7-12-6-4-11-8-15-9-14-11/h1-3,5,8-9,12H,4,6-7H2 |
| InChIKey | SIXBPXHBCIRVME-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|