C9H12N4S — CID 63829341
N-(1H-imidazol-2-ylmethyl)-2-(1,3-thiazol-4-yl)ethanamine (PubChem CID 63829341) has the molecular formula C9H12N4S and a molecular weight of 208.29 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-2-(1,3-thiazol-4-yl)ethanamine.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-2-(1,3-thiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 63829341 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-2-(1,3-thiazol-4-yl)ethanamine |
| SMILES | c1c[nH]c(CNCCc2cscn2)n1 |
| InChI | InChI=1S/C9H12N4S/c1(8-6-14-7-13-8)2-10-5-9-11-3-4-12-9/h3-4,6-7,10H,1-2,5H2,(H,11,12) |
| InChIKey | IEZLJBBOZIUPMC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|