C8H15N3 — CID 46784320
N-(1H-imidazol-2-ylmethyl)-2-methylpropan-1-amine (PubChem CID 46784320) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-2-methylpropan-1-amine.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 46784320 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1ncc[nH]1 |
| InChI | InChI=1S/C8H15N3/c1-7(2)5-9-6-8-10-3-4-11-8/h3-4,7,9H,5-6H2,1-2H3,(H,10,11) |
| InChIKey | NIXCAKDNCGAAKR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |