C12H23N3 — CID 102904708
N-(1H-imidazol-2-ylmethyl)-3-methyl-2-propan-2-ylbutan-1-amine (PubChem CID 102904708) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is N-(1H-imidazol-2-ylmethyl)-3-methyl-2-propan-2-ylbutan-1-amine.
| Compound Name | N-(1H-imidazol-2-ylmethyl)-3-methyl-2-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 102904708 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | N-(1H-imidazol-2-ylmethyl)-3-methyl-2-propan-2-ylbutan-1-amine |
| SMILES | CC(C)C(CNCc1ncc[nH]1)C(C)C |
| InChI | InChI=1S/C12H23N3/c1-9(2)11(10(3)4)7-13-8-12-14-5-6-15-12/h5-6,9-11,13H,7-8H2,1-4H3,(H,14,15) |
| InChIKey | COYLDLAPJGNFFX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |