C11H13N3OS — CID 79794984
6-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]pyridin-3-ol (PubChem CID 79794984) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 6-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]pyridin-3-ol.
| Compound Name | 6-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 79794984 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 6-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]pyridin-3-ol |
| SMILES | Oc1ccc(CNCCc2cscn2)nc1 |
| InChI | InChI=1S/C11H13N3OS/c15-11-2-1-9(13-6-11)5-12-4-3-10-7-16-8-14-10/h1-2,6-8,12,15H,3-5H2 |
| InChIKey | IBMTZLICXSPASP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|