C10H12N2S2 — CID 63829370
2-(1,3-thiazol-4-yl)-N-(thiophen-2-ylmethyl)ethanamine (PubChem CID 63829370) has the molecular formula C10H12N2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-(1,3-thiazol-4-yl)-N-(thiophen-2-ylmethyl)ethanamine.
| Compound Name | 2-(1,3-thiazol-4-yl)-N-(thiophen-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 63829370 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-(1,3-thiazol-4-yl)-N-(thiophen-2-ylmethyl)ethanamine |
| SMILES | c1csc(CNCCc2cscn2)c1 |
| InChI | InChI=1S/C10H12N2S2/c1-2-10(14-5-1)6-11-4-3-9-7-13-8-12-9/h1-2,5,7-8,11H,3-4,6H2 |
| InChIKey | NTDKUWBKDBYRLA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|