C16H17N3S — CID 63824853
3-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]naphthalen-2-amine (PubChem CID 63824853) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is 3-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]naphthalen-2-amine.
| Compound Name | 3-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 63824853 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]naphthalen-2-amine |
| SMILES | Nc1cc2ccccc2cc1CNCCc1cscn1 |
| InChI | InChI=1S/C16H17N3S/c17-16-8-13-4-2-1-3-12(13)7-14(16)9-18-6-5-15-10-20-11-19-15/h1-4,7-8,10-11,18H,5-6,9,17H2 |
| InChIKey | JSTCPJPLZOIPQN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|