C13H17N3S — CID 63825390
4-[2-[2-(1,3-thiazol-4-yl)ethylamino]ethyl]aniline (PubChem CID 63825390) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is 4-[2-[2-(1,3-thiazol-4-yl)ethylamino]ethyl]aniline.
| Compound Name | 4-[2-[2-(1,3-thiazol-4-yl)ethylamino]ethyl]aniline |
|---|---|
| PubChem CID | 63825390 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 4-[2-[2-(1,3-thiazol-4-yl)ethylamino]ethyl]aniline |
| SMILES | Nc1ccc(CCNCCc2cscn2)cc1 |
| InChI | InChI=1S/C13H17N3S/c14-12-3-1-11(2-4-12)5-7-15-8-6-13-9-17-10-16-13/h1-4,9-10,15H,5-8,14H2 |
| InChIKey | CKXPTEVOIHCYOP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|