C13H15N3OS — CID 110483325
N-[2-(4-aminophenyl)ethyl]-2-(1,3-thiazol-4-yl)acetamide (PubChem CID 110483325) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-(1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-(1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 110483325 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-(1,3-thiazol-4-yl)acetamide |
| SMILES | Nc1ccc(CCNC(=O)Cc2cscn2)cc1 |
| InChI | InChI=1S/C13H15N3OS/c14-11-3-1-10(2-4-11)5-6-15-13(17)7-12-8-18-9-16-12/h1-4,8-9H,5-7,14H2,(H,15,17) |
| InChIKey | UUMLWJNIWFUJJZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|