C5H7N3OS — CID 53297918
2-(1,3-thiazol-4-yl)acetohydrazide (PubChem CID 53297918) has the molecular formula C5H7N3OS and a molecular weight of 157.20 g/mol. Its IUPAC name is 2-(1,3-thiazol-4-yl)acetohydrazide.
| Compound Name | 2-(1,3-thiazol-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 53297918 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 2-(1,3-thiazol-4-yl)acetohydrazide |
| SMILES | NNC(=O)Cc1cscn1 |
| InChI | InChI=1S/C5H7N3OS/c6-8-5(9)1-4-2-10-3-7-4/h2-3H,1,6H2,(H,8,9) |
| InChIKey | FODOKIAJODLDSB-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|