About CID 163960954
CID 163960954 (PubChem CID 163960954) has the molecular formula C7H9N2OS2-
and a molecular weight of 201.30 g/mol.
Molecular Properties
| Compound Name | CID 163960954 |
| PubChem CID | 163960954 |
| Molecular Formula | C7H9N2OS2- |
| Molecular Weight | 201.30 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | — |
| SMILES | C=[S-](=C)NC(=O)Cc1cscn1 |
| InChI | InChI=1S/C7H9N2OS2/c1-12(2)9-7(10)3-6-4-11-5-8-6/h4-5H,1-3H2,(H,9,10)/q-1 |
| InChIKey | SDAQPAADSWGXEX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.30 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 163960954 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163960954?
The IUPAC name of CID 163960954 (CID 163960954) is not available.
What is the SMILES notation for CID 163960954?
The canonical SMILES for CID 163960954 is C=[S-](=C)NC(=O)Cc1cscn1.
What is the InChIKey of CID 163960954?
The InChIKey is SDAQPAADSWGXEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N2OS2/c1-12(2)9-7(10)3-6-4-11-5-8-6/h4-5H,1-3H2,(H,9,10)/q-1.
What are the key properties of CID 163960954?
CID 163960954 has a molecular weight of 201.30 g/mol, XLogP of 0.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163960954 is sourced from PubChem (CID 163960954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).