C8H12N2OS — CID 62185365
2-methyl-N-(1,3-thiazol-4-ylmethyl)propanamide (PubChem CID 62185365) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-methyl-N-(1,3-thiazol-4-ylmethyl)propanamide.
| Compound Name | 2-methyl-N-(1,3-thiazol-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 62185365 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-methyl-N-(1,3-thiazol-4-ylmethyl)propanamide |
| SMILES | CC(C)C(=O)NCc1cscn1 |
| InChI | InChI=1S/C8H12N2OS/c1-6(2)8(11)9-3-7-4-12-5-10-7/h4-6H,3H2,1-2H3,(H,9,11) |
| InChIKey | YBCJYCQOYBYLMO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |