C9H15N3OS — CID 49483238
1-butan-2-yl-3-(1,3-thiazol-4-ylmethyl)urea (PubChem CID 49483238) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 1-butan-2-yl-3-(1,3-thiazol-4-ylmethyl)urea.
| Compound Name | 1-butan-2-yl-3-(1,3-thiazol-4-ylmethyl)urea |
|---|---|
| PubChem CID | 49483238 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 1-butan-2-yl-3-(1,3-thiazol-4-ylmethyl)urea |
| SMILES | CCC(C)NC(=O)NCc1cscn1 |
| InChI | InChI=1S/C9H15N3OS/c1-3-7(2)12-9(13)10-4-8-5-14-6-11-8/h5-7H,3-4H2,1-2H3,(H2,10,12,13) |
| InChIKey | FHRLNXKFPUAIHM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |