C14H15N3O3S — CID 63825576
3-phenyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)propanoic acid (PubChem CID 63825576) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 3-phenyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)propanoic acid.
| Compound Name | 3-phenyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 63825576 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-phenyl-3-(1,3-thiazol-4-ylmethylcarbamoylamino)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)NCc1cscn1)c1ccccc1 |
| InChI | InChI=1S/C14H15N3O3S/c18-13(19)6-12(10-4-2-1-3-5-10)17-14(20)15-7-11-8-21-9-16-11/h1-5,8-9,12H,6-7H2,(H,18,19)(H2,15,17,20) |
| InChIKey | NDBXIVLKWRIIMK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |