C14H17N3O2S — CID 111454997
1-[(1R)-3-hydroxy-1-phenylpropyl]-3-(1,3-thiazol-4-ylmethyl)urea (PubChem CID 111454997) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 1-[(1R)-3-hydroxy-1-phenylpropyl]-3-(1,3-thiazol-4-ylmethyl)urea.
| Compound Name | 1-[(1R)-3-hydroxy-1-phenylpropyl]-3-(1,3-thiazol-4-ylmethyl)urea |
|---|---|
| PubChem CID | 111454997 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-[(1R)-3-hydroxy-1-phenylpropyl]-3-(1,3-thiazol-4-ylmethyl)urea |
| SMILES | O=C(NCc1cscn1)N[C@H](CCO)c1ccccc1 |
| InChI | InChI=1S/C14H17N3O2S/c18-7-6-13(11-4-2-1-3-5-11)17-14(19)15-8-12-9-20-10-16-12/h1-5,9-10,13,18H,6-8H2,(H2,15,17,19)/t13-/m1/s1 |
| InChIKey | SZWCSRBGZXSLCC-CYBMUJFWSA-N |
| XLogP | 2.07 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |