C17H18F2N2O2 — CID 111455268
1-[(2,5-difluorophenyl)methyl]-3-[(1R)-3-hydroxy-1-phenylpropyl]urea (PubChem CID 111455268) has the molecular formula C17H18F2N2O2 and a molecular weight of 320.34 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-[(1R)-3-hydroxy-1-phenylpropyl]urea.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-[(1R)-3-hydroxy-1-phenylpropyl]urea |
|---|---|
| PubChem CID | 111455268 |
| Molecular Formula | C17H18F2N2O2 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-[(1R)-3-hydroxy-1-phenylpropyl]urea |
| SMILES | O=C(NCc1cc(F)ccc1F)N[C@H](CCO)c1ccccc1 |
| InChI | InChI=1S/C17H18F2N2O2/c18-14-6-7-15(19)13(10-14)11-20-17(23)21-16(8-9-22)12-4-2-1-3-5-12/h1-7,10,16,22H,8-9,11H2,(H2,20,21,23)/t16-/m1/s1 |
| InChIKey | XYRNNYPKAKRAHQ-MRXNPFEDSA-N |
| XLogP | 2.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |