About 4-[(2,5-Difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid
4-[(2,5-Difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid (PubChem CID 122000989) has the molecular formula C19H20F2N2O3
and a molecular weight of 362.40 g/mol. Its IUPAC name is 4-[(2,5-difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid.
Molecular Properties
| Compound Name | 4-[(2,5-Difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid |
| PubChem CID | 122000989 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 4-[(2,5-difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid |
| SMILES | C1=CC=C(C=C1)CC(CCC(=O)O)NC(=O)NCC2=C(C=CC(=C2)F)F |
| InChI | InChI=1S/C19H20F2N2O3/c20-15-6-8-17(21)14(11-15)12-22-19(26)23-16(7-9-18(24)25)10-13-4-2-1-3-5-13/h1-6,8,11,16H,7,9-10,12H2,(H,24,25)(H2,22,23,26) |
| InChIKey | ZQYHXDJMTWVWSH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | 458 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2,5-Difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-Difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid?
The IUPAC name of 4-[(2,5-Difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid (CID 122000989) is 4-[(2,5-difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid.
What is the SMILES notation for 4-[(2,5-Difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid?
The canonical SMILES for 4-[(2,5-Difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid is C1=CC=C(C=C1)CC(CCC(=O)O)NC(=O)NCC2=C(C=CC(=C2)F)F.
What is the InChIKey of 4-[(2,5-Difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid?
The InChIKey is ZQYHXDJMTWVWSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F2N2O3/c20-15-6-8-17(21)14(11-15)12-22-19(26)23-16(7-9-18(24)25)10-13-4-2-1-3-5-13/h1-6,8,11,16H,7,9-10,12H2,(H,24,25)(H2,22,23,26).
What are the key properties of 4-[(2,5-Difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid?
4-[(2,5-Difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid has a molecular weight of 362.40 g/mol, XLogP of 2.90, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-Difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid is sourced from PubChem (CID 122000989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).