C19H20F2N2O3 — CID 122000989
4-[(2,5-difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid (PubChem CID 122000989) has the molecular formula C19H20F2N2O3 and a molecular weight of 362.38 g/mol. Its IUPAC name is 4-[(2,5-difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(2,5-difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122000989 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 4-[(2,5-difluorophenyl)methylcarbamoylamino]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C19H20F2N2O3/c20-15-6-8-17(21)14(11-15)12-22-19(26)23-16(7-9-18(24)25)10-13-4-2-1-3-5-13/h1-6,8,11,16H,7,9-10,12H2,(H,24,25)(H2,22,23,26) |
| InChIKey | ZQYHXDJMTWVWSH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |