C17H21N5O3 — CID 122028214
4-[(4-aminopyrimidin-5-yl)methylcarbamoylamino]-5-phenylpentanoic acid (PubChem CID 122028214) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 4-[(4-aminopyrimidin-5-yl)methylcarbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(4-aminopyrimidin-5-yl)methylcarbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122028214 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 4-[(4-aminopyrimidin-5-yl)methylcarbamoylamino]-5-phenylpentanoic acid |
| SMILES | Nc1ncncc1CNC(=O)NC(CCC(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C17H21N5O3/c18-16-13(9-19-11-21-16)10-20-17(25)22-14(6-7-15(23)24)8-12-4-2-1-3-5-12/h1-5,9,11,14H,6-8,10H2,(H,23,24)(H2,18,19,21)(H2,20,22,25) |
| InChIKey | DSSQDKXBRWQNGH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |