C17H21ClN4O3 — CID 122016344
4-[(4-chloro-1-methylpyrazol-3-yl)methylcarbamoylamino]-5-phenylpentanoic acid (PubChem CID 122016344) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is 4-[(4-chloro-1-methylpyrazol-3-yl)methylcarbamoylamino]-5-phenylpentanoic acid.
| Compound Name | 4-[(4-chloro-1-methylpyrazol-3-yl)methylcarbamoylamino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 122016344 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 4-[(4-chloro-1-methylpyrazol-3-yl)methylcarbamoylamino]-5-phenylpentanoic acid |
| SMILES | Cn1cc(Cl)c(CNC(=O)NC(CCC(=O)O)Cc2ccccc2)n1 |
| InChI | InChI=1S/C17H21ClN4O3/c1-22-11-14(18)15(21-22)10-19-17(25)20-13(7-8-16(23)24)9-12-5-3-2-4-6-12/h2-6,11,13H,7-10H2,1H3,(H,23,24)(H2,19,20,25) |
| InChIKey | NJKWVMJDOVCMDS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |