C19H20F3N3O3 — CID 122016176
5-phenyl-4-[[2-(trifluoromethyl)-4-pyridinyl]methylcarbamoylamino]pentanoic acid (PubChem CID 122016176) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is 5-phenyl-4-[[2-(trifluoromethyl)-4-pyridinyl]methylcarbamoylamino]pentanoic acid.
| Compound Name | 5-phenyl-4-[[2-(trifluoromethyl)-4-pyridinyl]methylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 122016176 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 5-phenyl-4-[[2-(trifluoromethyl)-4-pyridinyl]methylcarbamoylamino]pentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)NCc1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20F3N3O3/c20-19(21,22)16-11-14(8-9-23-16)12-24-18(28)25-15(6-7-17(26)27)10-13-4-2-1-3-5-13/h1-5,8-9,11,15H,6-7,10,12H2,(H,26,27)(H2,24,25,28) |
| InChIKey | ZXETUZAJIUPAEH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |