C15H17F2N3OS — CID 97224466
1-[(1S)-1-(2,4-difluorophenyl)butyl]-3-(1,3-thiazol-4-ylmethyl)urea (PubChem CID 97224466) has the molecular formula C15H17F2N3OS and a molecular weight of 325.38 g/mol. Its IUPAC name is 1-[(1S)-1-(2,4-difluorophenyl)butyl]-3-(1,3-thiazol-4-ylmethyl)urea.
| Compound Name | 1-[(1S)-1-(2,4-difluorophenyl)butyl]-3-(1,3-thiazol-4-ylmethyl)urea |
|---|---|
| PubChem CID | 97224466 |
| Molecular Formula | C15H17F2N3OS |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 1-[(1S)-1-(2,4-difluorophenyl)butyl]-3-(1,3-thiazol-4-ylmethyl)urea |
| SMILES | CCC[C@H](NC(=O)NCc1cscn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H17F2N3OS/c1-2-3-14(12-5-4-10(16)6-13(12)17)20-15(21)18-7-11-8-22-9-19-11/h4-6,8-9,14H,2-3,7H2,1H3,(H2,18,20,21)/t14-/m0/s1 |
| InChIKey | KOFIKBDQZTYOHL-AWEZNQCLSA-N |
| XLogP | 3.76 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |