C16H19N3O2S — CID 92883121
(2R)-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]-2-phenylbutanamide (PubChem CID 92883121) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is (2R)-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]-2-phenylbutanamide.
| Compound Name | (2R)-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 92883121 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (2R)-N-[2-oxo-2-(1,3-thiazol-4-ylmethylamino)ethyl]-2-phenylbutanamide |
| SMILES | CC[C@@H](C(=O)NCC(=O)NCc1cscn1)c1ccccc1 |
| InChI | InChI=1S/C16H19N3O2S/c1-2-14(12-6-4-3-5-7-12)16(21)18-9-15(20)17-8-13-10-22-11-19-13/h3-7,10-11,14H,2,8-9H2,1H3,(H,17,20)(H,18,21)/t14-/m1/s1 |
| InChIKey | QQCNTYQCNUHWBD-CQSZACIVSA-N |
| XLogP | 2.07 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |