C10H17N3O2S — CID 111338339
1-(2-hydroxypentyl)-3-(1,3-thiazol-4-ylmethyl)urea (PubChem CID 111338339) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-(2-hydroxypentyl)-3-(1,3-thiazol-4-ylmethyl)urea.
| Compound Name | 1-(2-hydroxypentyl)-3-(1,3-thiazol-4-ylmethyl)urea |
|---|---|
| PubChem CID | 111338339 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-(2-hydroxypentyl)-3-(1,3-thiazol-4-ylmethyl)urea |
| SMILES | CCCC(O)CNC(=O)NCc1cscn1 |
| InChI | InChI=1S/C10H17N3O2S/c1-2-3-9(14)5-12-10(15)11-4-8-6-16-7-13-8/h6-7,9,14H,2-5H2,1H3,(H2,11,12,15) |
| InChIKey | UITMGNUZWSRDSB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |