C13H13F3N2S2 — CID 63830413
2-(1,3-thiazol-4-yl)-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]ethanamine (PubChem CID 63830413) has the molecular formula C13H13F3N2S2 and a molecular weight of 318.39 g/mol. Its IUPAC name is 2-(1,3-thiazol-4-yl)-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]ethanamine.
| Compound Name | 2-(1,3-thiazol-4-yl)-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 63830413 |
| Molecular Formula | C13H13F3N2S2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-(1,3-thiazol-4-yl)-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]ethanamine |
| SMILES | FC(F)(F)Sc1ccc(CNCCc2cscn2)cc1 |
| InChI | InChI=1S/C13H13F3N2S2/c14-13(15,16)20-12-3-1-10(2-4-12)7-17-6-5-11-8-19-9-18-11/h1-4,8-9,17H,5-7H2 |
| InChIKey | BNTXRCFXYGNGBL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|