C12H12ClFN2S — CID 81145010
N-[(3-chloro-4-fluorophenyl)methyl]-2-(1,3-thiazol-4-yl)ethanamine (PubChem CID 81145010) has the molecular formula C12H12ClFN2S and a molecular weight of 270.76 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-2-(1,3-thiazol-4-yl)ethanamine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-2-(1,3-thiazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 81145010 |
| Molecular Formula | C12H12ClFN2S |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-2-(1,3-thiazol-4-yl)ethanamine |
| SMILES | Fc1ccc(CNCCc2cscn2)cc1Cl |
| InChI | InChI=1S/C12H12ClFN2S/c13-11-5-9(1-2-12(11)14)6-15-4-3-10-7-17-8-16-10/h1-2,5,7-8,15H,3-4,6H2 |
| InChIKey | URBPIBHPEBMLJK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|