C12H13ClN2S — CID 115596018
2-(2-chlorophenyl)-N-(1,3-thiazol-4-ylmethyl)ethanamine (PubChem CID 115596018) has the molecular formula C12H13ClN2S and a molecular weight of 252.77 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(1,3-thiazol-4-ylmethyl)ethanamine.
| Compound Name | 2-(2-chlorophenyl)-N-(1,3-thiazol-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115596018 |
| Molecular Formula | C12H13ClN2S |
| Molecular Weight | 252.77 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(1,3-thiazol-4-ylmethyl)ethanamine |
| SMILES | Clc1ccccc1CCNCc1cscn1 |
| InChI | InChI=1S/C12H13ClN2S/c13-12-4-2-1-3-10(12)5-6-14-7-11-8-16-9-15-11/h1-4,8-9,14H,5-7H2 |
| InChIKey | QUOJPBLYHWCXRL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|