C19H26INO8 — CID 71345430
3-O-tert-butyl 1-O-iodo 2-[(3,4-dihydroxyphenyl)methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate (PubChem CID 71345430) has the molecular formula C19H26INO8 and a molecular weight of 523.32 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-iodo 2-[(3,4-dihydroxyphenyl)methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate.
| Compound Name | 3-O-tert-butyl 1-O-iodo 2-[(3,4-dihydroxyphenyl)methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
|---|---|
| PubChem CID | 71345430 |
| Molecular Formula | C19H26INO8 |
| Molecular Weight | 523.32 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 3-O-tert-butyl 1-O-iodo 2-[(3,4-dihydroxyphenyl)methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(O)c(O)c1)(C(=O)OI)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26INO8/c1-17(2,3)27-14(24)19(15(25)29-20,21-16(26)28-18(4,5)6)10-11-7-8-12(22)13(23)9-11/h7-9,22-23H,10H2,1-6H3,(H,21,26) |
| InChIKey | PVUFKRSMPKGXJZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|