C19H26INO6 — CID 67189170
diethyl 2-[(3-iodophenyl)methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate (PubChem CID 67189170) has the molecular formula C19H26INO6 and a molecular weight of 491.32 g/mol. Its IUPAC name is diethyl 2-[(3-iodophenyl)methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate.
| Compound Name | diethyl 2-[(3-iodophenyl)methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
|---|---|
| PubChem CID | 67189170 |
| Molecular Formula | C19H26INO6 |
| Molecular Weight | 491.32 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | diethyl 2-[(3-iodophenyl)methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
| SMILES | CCOC(=O)C(Cc1cccc(I)c1)(NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C19H26INO6/c1-6-25-15(22)19(16(23)26-7-2,21-17(24)27-18(3,4)5)12-13-9-8-10-14(20)11-13/h8-11H,6-7,12H2,1-5H3,(H,21,24) |
| InChIKey | YIYXGBXGVRDUNR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|