C14H24N2O7 — CID 86661710
diethyl (2R)-2-carbamoyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 86661710) has the molecular formula C14H24N2O7 and a molecular weight of 332.35 g/mol. Its IUPAC name is diethyl (2R)-2-carbamoyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | diethyl (2R)-2-carbamoyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 86661710 |
| Molecular Formula | C14H24N2O7 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | diethyl (2R)-2-carbamoyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | CCOC(=O)C[C@@](NC(=O)OC(C)(C)C)(C(N)=O)C(=O)OCC |
| InChI | InChI=1S/C14H24N2O7/c1-6-21-9(17)8-14(10(15)18,11(19)22-7-2)16-12(20)23-13(3,4)5/h6-8H2,1-5H3,(H2,15,18)(H,16,20)/t14-/m1/s1 |
| InChIKey | GDCZUSVPIXDNDQ-CQSZACIVSA-N |
| XLogP | 0.25 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|