C19H33NO6 — CID 102484738
diethyl 2-hept-6-enyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate (PubChem CID 102484738) has the molecular formula C19H33NO6 and a molecular weight of 371.47 g/mol. Its IUPAC name is diethyl 2-hept-6-enyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate.
| Compound Name | diethyl 2-hept-6-enyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
|---|---|
| PubChem CID | 102484738 |
| Molecular Formula | C19H33NO6 |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | diethyl 2-hept-6-enyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
| SMILES | C=CCCCCCC(NC(=O)OC(C)(C)C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C19H33NO6/c1-7-10-11-12-13-14-19(15(21)24-8-2,16(22)25-9-3)20-17(23)26-18(4,5)6/h7H,1,8-14H2,2-6H3,(H,20,23) |
| InChIKey | QUAMAWMBICYZJO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|