C14H25N3O4 — CID 54305171
ethyl 6-amino-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 54305171) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is ethyl 6-amino-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | ethyl 6-amino-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 54305171 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | ethyl 6-amino-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CCOC(=O)C(C#N)(CCCCN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25N3O4/c1-5-20-11(18)14(10-16,8-6-7-9-15)17-12(19)21-13(2,3)4/h5-9,15H2,1-4H3,(H,17,19) |
| InChIKey | SGZIKUZMFLKSHQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|