C22H39BN2O6 — CID 140831276
tert-butyl 2-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate (PubChem CID 140831276) has the molecular formula C22H39BN2O6 and a molecular weight of 438.37 g/mol. Its IUPAC name is tert-butyl 2-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate.
| Compound Name | tert-butyl 2-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
|---|---|
| PubChem CID | 140831276 |
| Molecular Formula | C22H39BN2O6 |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | tert-butyl 2-cyano-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
| SMILES | CC(C)(C)OC(=O)NC(C#N)(CCCCB1OC(C)(C)C(C)(C)O1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H39BN2O6/c1-18(2,3)28-16(26)22(15-24,25-17(27)29-19(4,5)6)13-11-12-14-23-30-20(7,8)21(9,10)31-23/h11-14H2,1-10H3,(H,25,27) |
| InChIKey | IXHMPYHJKSOOJB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 106.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|