C17H33BN2O5 — CID 140831223
ethyl 2-acetamido-2-(aminomethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate (PubChem CID 140831223) has the molecular formula C17H33BN2O5 and a molecular weight of 356.27 g/mol. Its IUPAC name is ethyl 2-acetamido-2-(aminomethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate.
| Compound Name | ethyl 2-acetamido-2-(aminomethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
|---|---|
| PubChem CID | 140831223 |
| Molecular Formula | C17H33BN2O5 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | ethyl 2-acetamido-2-(aminomethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
| SMILES | CCOC(=O)C(CN)(CCCCB1OC(C)(C)C(C)(C)O1)NC(C)=O |
| InChI | InChI=1S/C17H33BN2O5/c1-7-23-14(22)17(12-19,20-13(2)21)10-8-9-11-18-24-15(3,4)16(5,6)25-18/h7-12,19H2,1-6H3,(H,20,21) |
| InChIKey | TZPSUZXFISWZAP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|